C13H18ClNO2 — CID 120510685
(2S)-2-[(4-chloro-3-methylphenyl)methylamino]-3-methylbutanoic acid (PubChem CID 120510685) has the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. Its IUPAC name is (2S)-2-[(4-chloro-3-methylphenyl)methylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(4-chloro-3-methylphenyl)methylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 120510685 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (2S)-2-[(4-chloro-3-methylphenyl)methylamino]-3-methylbutanoic acid |
| SMILES | Cc1cc(CN[C@H](C(=O)O)C(C)C)ccc1Cl |
| InChI | InChI=1S/C13H18ClNO2/c1-8(2)12(13(16)17)15-7-10-4-5-11(14)9(3)6-10/h4-6,8,12,15H,7H2,1-3H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | AOVXTLCSYVSJPR-LBPRGKRZSA-N |
| XLogP | 2.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |