C20H24ClNO4 — CID 99123787
(2S)-2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-3-methylbutanoic acid (PubChem CID 99123787) has the molecular formula C20H24ClNO4 and a molecular weight of 377.87 g/mol. Its IUPAC name is (2S)-2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 99123787 |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (2S)-2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-3-methylbutanoic acid |
| SMILES | COc1cc(CN[C@H](C(=O)O)C(C)C)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H24ClNO4/c1-13(2)19(20(23)24)22-11-15-6-9-17(18(10-15)25-3)26-12-14-4-7-16(21)8-5-14/h4-10,13,19,22H,11-12H2,1-3H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | JDWPRUSOKLCEAY-IBGZPJMESA-N |
| XLogP | 4.13 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |