C20H26ClNO2 — CID 40726642
(2S)-N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]butan-2-amine (PubChem CID 40726642) has the molecular formula C20H26ClNO2 and a molecular weight of 347.89 g/mol. Its IUPAC name is (2S)-N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]butan-2-amine.
| Compound Name | (2S)-N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 40726642 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2S)-N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]butan-2-amine |
| SMILES | CCOc1cc(CN[C@@H](C)CC)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H26ClNO2/c1-4-15(3)22-13-17-8-11-19(20(12-17)23-5-2)24-14-16-6-9-18(21)10-7-16/h6-12,15,22H,4-5,13-14H2,1-3H3/t15-/m0/s1 |
| InChIKey | KMPQKPSYQYNBIQ-HNNXBMFYSA-N |
| XLogP | 5.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |