C19H25Cl2NO2 — CID 17291372
N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]butan-2-amine;hydrochloride (PubChem CID 17291372) has the molecular formula C19H25Cl2NO2 and a molecular weight of 370.32 g/mol. Its IUPAC name is N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]butan-2-amine;hydrochloride.
| Compound Name | N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 17291372 |
| Molecular Formula | C19H25Cl2NO2 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]butan-2-amine;hydrochloride |
| SMILES | CCC(C)NCc1ccc(OCc2ccc(Cl)cc2)c(OC)c1.Cl |
| InChI | InChI=1S/C19H24ClNO2.ClH/c1-4-14(2)21-12-16-7-10-18(19(11-16)22-3)23-13-15-5-8-17(20)9-6-15;/h5-11,14,21H,4,12-13H2,1-3H3;1H |
| InChIKey | QQYGOEOBNSCDGH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |