C11H19NOS — CID 107784170
1-(2-methylfuran-3-yl)sulfanyl-N-propylpropan-2-amine (PubChem CID 107784170) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is 1-(2-methylfuran-3-yl)sulfanyl-N-propylpropan-2-amine.
| Compound Name | 1-(2-methylfuran-3-yl)sulfanyl-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 107784170 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 1-(2-methylfuran-3-yl)sulfanyl-N-propylpropan-2-amine |
| SMILES | CCCNC(C)CSc1ccoc1C |
| InChI | InChI=1S/C11H19NOS/c1-4-6-12-9(2)8-14-11-5-7-13-10(11)3/h5,7,9,12H,4,6,8H2,1-3H3 |
| InChIKey | IVOGBHSOLXEKBF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |