C12H21NOS — CID 107784089
N-ethyl-3-methyl-1-(2-methylfuran-3-yl)sulfanylbutan-2-amine (PubChem CID 107784089) has the molecular formula C12H21NOS and a molecular weight of 227.37 g/mol. Its IUPAC name is N-ethyl-3-methyl-1-(2-methylfuran-3-yl)sulfanylbutan-2-amine.
| Compound Name | N-ethyl-3-methyl-1-(2-methylfuran-3-yl)sulfanylbutan-2-amine |
|---|---|
| PubChem CID | 107784089 |
| Molecular Formula | C12H21NOS |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-ethyl-3-methyl-1-(2-methylfuran-3-yl)sulfanylbutan-2-amine |
| SMILES | CCNC(CSc1ccoc1C)C(C)C |
| InChI | InChI=1S/C12H21NOS/c1-5-13-11(9(2)3)8-15-12-6-7-14-10(12)4/h6-7,9,11,13H,5,8H2,1-4H3 |
| InChIKey | HXTRPSPUWJYWSA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |