C8H12O3S — CID 104922695
3-(2-methylfuran-3-yl)sulfanylpropane-1,2-diol (PubChem CID 104922695) has the molecular formula C8H12O3S and a molecular weight of 188.25 g/mol. Its IUPAC name is 3-(2-methylfuran-3-yl)sulfanylpropane-1,2-diol.
| Compound Name | 3-(2-methylfuran-3-yl)sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 104922695 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 3-(2-methylfuran-3-yl)sulfanylpropane-1,2-diol |
| SMILES | Cc1occc1SCC(O)CO |
| InChI | InChI=1S/C8H12O3S/c1-6-8(2-3-11-6)12-5-7(10)4-9/h2-3,7,9-10H,4-5H2,1H3 |
| InChIKey | ZBNLLPNCWPBSBK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |