C14H20Cl2N2 — CID 83931363
1-[3-(2,5-dichlorophenyl)propyl]-1,4-diazepane (PubChem CID 83931363) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is 1-[3-(2,5-dichlorophenyl)propyl]-1,4-diazepane.
| Compound Name | 1-[3-(2,5-dichlorophenyl)propyl]-1,4-diazepane |
|---|---|
| PubChem CID | 83931363 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-[3-(2,5-dichlorophenyl)propyl]-1,4-diazepane |
| SMILES | Clc1ccc(Cl)c(CCCN2CCCNCC2)c1 |
| InChI | InChI=1S/C14H20Cl2N2/c15-13-4-5-14(16)12(11-13)3-1-8-18-9-2-6-17-7-10-18/h4-5,11,17H,1-3,6-10H2 |
| InChIKey | XTMMHXNNIPCHHI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |