C15H19Cl2N3 — CID 83949063
6,7-dichloro-3-(3-piperazin-1-ylpropyl)-1H-indole (PubChem CID 83949063) has the molecular formula C15H19Cl2N3 and a molecular weight of 312.24 g/mol. Its IUPAC name is 6,7-dichloro-3-(3-piperazin-1-ylpropyl)-1H-indole.
| Compound Name | 6,7-dichloro-3-(3-piperazin-1-ylpropyl)-1H-indole |
|---|---|
| PubChem CID | 83949063 |
| Molecular Formula | C15H19Cl2N3 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 6,7-dichloro-3-(3-piperazin-1-ylpropyl)-1H-indole |
| SMILES | Clc1ccc2c(CCCN3CCNCC3)c[nH]c2c1Cl |
| InChI | InChI=1S/C15H19Cl2N3/c16-13-4-3-12-11(10-19-15(12)14(13)17)2-1-7-20-8-5-18-6-9-20/h3-4,10,18-19H,1-2,5-9H2 |
| InChIKey | HRZAYOIDWHGWCD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |