C13H21N3 — CID 82161391
2-(3-piperazin-1-ylpropyl)aniline (PubChem CID 82161391) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-(3-piperazin-1-ylpropyl)aniline.
| Compound Name | 2-(3-piperazin-1-ylpropyl)aniline |
|---|---|
| PubChem CID | 82161391 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 2-(3-piperazin-1-ylpropyl)aniline |
| SMILES | Nc1ccccc1CCCN1CCNCC1 |
| InChI | InChI=1S/C13H21N3/c14-13-6-2-1-4-12(13)5-3-9-16-10-7-15-8-11-16/h1-2,4,6,15H,3,5,7-11,14H2 |
| InChIKey | YUANJELGCGVBBH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|