C14H22N2 — CID 28721004
2-(3-piperidin-1-ylpropyl)aniline (PubChem CID 28721004) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-(3-piperidin-1-ylpropyl)aniline.
| Compound Name | 2-(3-piperidin-1-ylpropyl)aniline |
|---|---|
| PubChem CID | 28721004 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-(3-piperidin-1-ylpropyl)aniline |
| SMILES | Nc1ccccc1CCCN1CCCCC1 |
| InChI | InChI=1S/C14H22N2/c15-14-9-3-2-7-13(14)8-6-12-16-10-4-1-5-11-16/h2-3,7,9H,1,4-6,8,10-12,15H2 |
| InChIKey | TVEZWPCYDHTJSL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|