C14H18ClN3 — CID 82501403
7-chloro-3-(1,4-diazepan-1-ylmethyl)-1H-indole (PubChem CID 82501403) has the molecular formula C14H18ClN3 and a molecular weight of 263.77 g/mol. Its IUPAC name is 7-chloro-3-(1,4-diazepan-1-ylmethyl)-1H-indole.
| Compound Name | 7-chloro-3-(1,4-diazepan-1-ylmethyl)-1H-indole |
|---|---|
| PubChem CID | 82501403 |
| Molecular Formula | C14H18ClN3 |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 7-chloro-3-(1,4-diazepan-1-ylmethyl)-1H-indole |
| SMILES | Clc1cccc2c(CN3CCCNCC3)c[nH]c12 |
| InChI | InChI=1S/C14H18ClN3/c15-13-4-1-3-12-11(9-17-14(12)13)10-18-7-2-5-16-6-8-18/h1,3-4,9,16-17H,2,5-8,10H2 |
| InChIKey | ZCXUOTKEDBQULG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |