C11H16ClN3 — CID 62471077
1-[(2-chloro-3-pyridinyl)methyl]-1,4-diazepane (PubChem CID 62471077) has the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(2-chloro-3-pyridinyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 62471077 |
| Molecular Formula | C11H16ClN3 |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)methyl]-1,4-diazepane |
| SMILES | Clc1ncccc1CN1CCCNCC1 |
| InChI | InChI=1S/C11H16ClN3/c12-11-10(3-1-5-14-11)9-15-7-2-4-13-6-8-15/h1,3,5,13H,2,4,6-9H2 |
| InChIKey | TZBJFKNZIVNFQW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|