C10H13ClN2O2 — CID 106668639
1-[(2-chloro-3-pyridinyl)methyl]pyrrolidine-3,4-diol (PubChem CID 106668639) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)methyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[(2-chloro-3-pyridinyl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106668639 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)methyl]pyrrolidine-3,4-diol |
| SMILES | OC1CN(Cc2cccnc2Cl)CC1O |
| InChI | InChI=1S/C10H13ClN2O2/c11-10-7(2-1-3-12-10)4-13-5-8(14)9(15)6-13/h1-3,8-9,14-15H,4-6H2 |
| InChIKey | QUNMVCJIVZEQKO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|