C15H19N3O2 — CID 96679886
7-(1,4-diazepan-1-ylmethyl)-5H-[1,3]dioxolo[4,5-f]indole (PubChem CID 96679886) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 7-(1,4-diazepan-1-ylmethyl)-5H-[1,3]dioxolo[4,5-f]indole.
| Compound Name | 7-(1,4-diazepan-1-ylmethyl)-5H-[1,3]dioxolo[4,5-f]indole |
|---|---|
| PubChem CID | 96679886 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 7-(1,4-diazepan-1-ylmethyl)-5H-[1,3]dioxolo[4,5-f]indole |
| SMILES | c1[nH]c2cc3c(cc2c1CN1CCCNCC1)OCO3 |
| InChI | InChI=1S/C15H19N3O2/c1-2-16-3-5-18(4-1)9-11-8-17-13-7-15-14(6-12(11)13)19-10-20-15/h6-8,16-17H,1-5,9-10H2 |
| InChIKey | JIQQVKRDERPPIN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |