C17H18Cl2N2O3S2 — CID 35352252
2-(2,5-dichlorophenyl)sulfanyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 35352252) has the molecular formula C17H18Cl2N2O3S2 and a molecular weight of 433.38 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 35352252 |
| Molecular Formula | C17H18Cl2N2O3S2 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)CSc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H18Cl2N2O3S2/c1-12-2-5-14(6-3-12)26(23,24)21-9-8-20-17(22)11-25-16-10-13(18)4-7-15(16)19/h2-7,10,21H,8-9,11H2,1H3,(H,20,22) |
| InChIKey | KJOSNVABPMWBFK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|