C16H23NOS — CID 115628128
3-(3,4-dimethylphenyl)sulfanyl-N-[(E)-pent-3-enyl]propanamide (PubChem CID 115628128) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)sulfanyl-N-[(E)-pent-3-enyl]propanamide.
| Compound Name | 3-(3,4-dimethylphenyl)sulfanyl-N-[(E)-pent-3-enyl]propanamide |
|---|---|
| PubChem CID | 115628128 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 3-(3,4-dimethylphenyl)sulfanyl-N-[(E)-pent-3-enyl]propanamide |
| SMILES | C/C=C/CCNC(=O)CCSc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H23NOS/c1-4-5-6-10-17-16(18)9-11-19-15-8-7-13(2)14(3)12-15/h4-5,7-8,12H,6,9-11H2,1-3H3,(H,17,18)/b5-4+ |
| InChIKey | ILRPMOFRIWJLDX-SNAWJCMRSA-N |
| XLogP | 3.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|