C11H18N2O3S — CID 106925058
ethyl 2-(ethylamino)-4-(1,3-oxazol-2-ylsulfanyl)butanoate (PubChem CID 106925058) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is ethyl 2-(ethylamino)-4-(1,3-oxazol-2-ylsulfanyl)butanoate.
| Compound Name | ethyl 2-(ethylamino)-4-(1,3-oxazol-2-ylsulfanyl)butanoate |
|---|---|
| PubChem CID | 106925058 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | ethyl 2-(ethylamino)-4-(1,3-oxazol-2-ylsulfanyl)butanoate |
| SMILES | CCNC(CCSc1ncco1)C(=O)OCC |
| InChI | InChI=1S/C11H18N2O3S/c1-3-12-9(10(14)15-4-2)5-8-17-11-13-6-7-16-11/h6-7,9,12H,3-5,8H2,1-2H3 |
| InChIKey | HAHZLNCEULKXRQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |