C15H21F2NO2S — CID 106807405
5-(2,5-difluorophenyl)sulfanyl-2-ethyl-2-(ethylamino)pentanoic acid (PubChem CID 106807405) has the molecular formula C15H21F2NO2S and a molecular weight of 317.40 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)sulfanyl-2-ethyl-2-(ethylamino)pentanoic acid.
| Compound Name | 5-(2,5-difluorophenyl)sulfanyl-2-ethyl-2-(ethylamino)pentanoic acid |
|---|---|
| PubChem CID | 106807405 |
| Molecular Formula | C15H21F2NO2S |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 5-(2,5-difluorophenyl)sulfanyl-2-ethyl-2-(ethylamino)pentanoic acid |
| SMILES | CCNC(CC)(CCCSc1cc(F)ccc1F)C(=O)O |
| InChI | InChI=1S/C15H21F2NO2S/c1-3-15(14(19)20,18-4-2)8-5-9-21-13-10-11(16)6-7-12(13)17/h6-7,10,18H,3-5,8-9H2,1-2H3,(H,19,20) |
| InChIKey | DPJGRSXNJJHTNR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|