C12H20N4S2 — CID 106805500
2-ethyl-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-(methylamino)pentanenitrile (PubChem CID 106805500) has the molecular formula C12H20N4S2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 2-ethyl-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-(methylamino)pentanenitrile.
| Compound Name | 2-ethyl-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-(methylamino)pentanenitrile |
|---|---|
| PubChem CID | 106805500 |
| Molecular Formula | C12H20N4S2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-ethyl-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-(methylamino)pentanenitrile |
| SMILES | CCc1nsc(SCCCC(C#N)(CC)NC)n1 |
| InChI | InChI=1S/C12H20N4S2/c1-4-10-15-11(18-16-10)17-8-6-7-12(5-2,9-13)14-3/h14H,4-8H2,1-3H3 |
| InChIKey | STOGYOIHCMJJDE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|