C14H22N4S2 — CID 106805499
2-(cyclopropylamino)-2-ethyl-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile (PubChem CID 106805499) has the molecular formula C14H22N4S2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-ethyl-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile.
| Compound Name | 2-(cyclopropylamino)-2-ethyl-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile |
|---|---|
| PubChem CID | 106805499 |
| Molecular Formula | C14H22N4S2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-(cyclopropylamino)-2-ethyl-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pentanenitrile |
| SMILES | CCc1nsc(SCCCC(C#N)(CC)NC2CC2)n1 |
| InChI | InChI=1S/C14H22N4S2/c1-3-12-16-13(20-18-12)19-9-5-8-14(4-2,10-15)17-11-6-7-11/h11,17H,3-9H2,1-2H3 |
| InChIKey | MCXLEBFHKOXVSU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|