C12H23N3OS2 — CID 106811158
2-ethyl-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-(methylamino)pentan-1-ol (PubChem CID 106811158) has the molecular formula C12H23N3OS2 and a molecular weight of 289.47 g/mol. Its IUPAC name is 2-ethyl-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-(methylamino)pentan-1-ol.
| Compound Name | 2-ethyl-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-(methylamino)pentan-1-ol |
|---|---|
| PubChem CID | 106811158 |
| Molecular Formula | C12H23N3OS2 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-ethyl-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-(methylamino)pentan-1-ol |
| SMILES | CCc1nsc(SCCCC(CC)(CO)NC)n1 |
| InChI | InChI=1S/C12H23N3OS2/c1-4-10-14-11(18-15-10)17-8-6-7-12(5-2,9-16)13-3/h13,16H,4-9H2,1-3H3 |
| InChIKey | ALCIUSOAGLFGES-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|