C17H23ClN2S — CID 106805548
5-[(2-chlorophenyl)methylsulfanyl]-2-(cyclopropylamino)-2-ethylpentanenitrile (PubChem CID 106805548) has the molecular formula C17H23ClN2S and a molecular weight of 322.90 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methylsulfanyl]-2-(cyclopropylamino)-2-ethylpentanenitrile.
| Compound Name | 5-[(2-chlorophenyl)methylsulfanyl]-2-(cyclopropylamino)-2-ethylpentanenitrile |
|---|---|
| PubChem CID | 106805548 |
| Molecular Formula | C17H23ClN2S |
| Molecular Weight | 322.90 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 5-[(2-chlorophenyl)methylsulfanyl]-2-(cyclopropylamino)-2-ethylpentanenitrile |
| SMILES | CCC(C#N)(CCCSCc1ccccc1Cl)NC1CC1 |
| InChI | InChI=1S/C17H23ClN2S/c1-2-17(13-19,20-15-8-9-15)10-5-11-21-12-14-6-3-4-7-16(14)18/h3-4,6-7,15,20H,2,5,8-12H2,1H3 |
| InChIKey | VTMBXPVJPFIZBK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.90 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|