C11H18N2OS — CID 102926755
1-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]butan-2-ol (PubChem CID 102926755) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 1-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]butan-2-ol.
| Compound Name | 1-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]butan-2-ol |
|---|---|
| PubChem CID | 102926755 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]butan-2-ol |
| SMILES | Cc1cc(C)nc(SCCC(O)CN)c1 |
| InChI | InChI=1S/C11H18N2OS/c1-8-5-9(2)13-11(6-8)15-4-3-10(14)7-12/h5-6,10,14H,3-4,7,12H2,1-2H3 |
| InChIKey | LVFUONBRFADZJA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |