C9H17N3OS — CID 64813400
1-amino-4-(2,5-dimethylpyrazol-3-yl)sulfanylbutan-2-ol (PubChem CID 64813400) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is 1-amino-4-(2,5-dimethylpyrazol-3-yl)sulfanylbutan-2-ol.
| Compound Name | 1-amino-4-(2,5-dimethylpyrazol-3-yl)sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 64813400 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 1-amino-4-(2,5-dimethylpyrazol-3-yl)sulfanylbutan-2-ol |
| SMILES | Cc1cc(SCCC(O)CN)n(C)n1 |
| InChI | InChI=1S/C9H17N3OS/c1-7-5-9(12(2)11-7)14-4-3-8(13)6-10/h5,8,13H,3-4,6,10H2,1-2H3 |
| InChIKey | DKURGGWARUHOOM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |