About 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine
2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine (PubChem CID 102924478) has the molecular formula C9H14N2S
and a molecular weight of 182.29 g/mol. Its IUPAC name is 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine.
Molecular Properties
| Compound Name | 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine |
| PubChem CID | 102924478 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine |
| SMILES | Cc1cc(C)nc(SCCN)c1 |
| InChI | InChI=1S/C9H14N2S/c1-7-5-8(2)11-9(6-7)12-4-3-10/h5-6H,3-4,10H2,1-2H3 |
| InChIKey | CQNBMVFNHCJMMQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine?
The IUPAC name of 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine (CID 102924478) is 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine.
What is the SMILES notation for 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine?
The canonical SMILES for 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine is Cc1cc(C)nc(SCCN)c1.
What is the InChIKey of 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine?
The InChIKey is CQNBMVFNHCJMMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2S/c1-7-5-8(2)11-9(6-7)12-4-3-10/h5-6H,3-4,10H2,1-2H3.
What are the key properties of 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine?
2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine has a molecular weight of 182.29 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine is sourced from PubChem (CID 102924478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).