About 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-4,6-dimethylpyridine
2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-4,6-dimethylpyridine (PubChem CID 102925442) has the molecular formula C13H19NO2S
and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-4,6-dimethylpyridine.
Molecular Properties
| Compound Name | 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-4,6-dimethylpyridine |
| PubChem CID | 102925442 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-4,6-dimethylpyridine |
| SMILES | Cc1cc(C)nc(SCCC2OCCCO2)c1 |
| InChI | InChI=1S/C13H19NO2S/c1-10-8-11(2)14-12(9-10)17-7-4-13-15-5-3-6-16-13/h8-9,13H,3-7H2,1-2H3 |
| InChIKey | MMARALIKZBKSSL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-4,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-4,6-dimethylpyridine?
The IUPAC name of 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-4,6-dimethylpyridine (CID 102925442) is 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-4,6-dimethylpyridine.
What is the SMILES notation for 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-4,6-dimethylpyridine?
The canonical SMILES for 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-4,6-dimethylpyridine is Cc1cc(C)nc(SCCC2OCCCO2)c1.
What is the InChIKey of 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-4,6-dimethylpyridine?
The InChIKey is MMARALIKZBKSSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2S/c1-10-8-11(2)14-12(9-10)17-7-4-13-15-5-3-6-16-13/h8-9,13H,3-7H2,1-2H3.
What are the key properties of 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-4,6-dimethylpyridine?
2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-4,6-dimethylpyridine has a molecular weight of 253.37 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-4,6-dimethylpyridine is sourced from PubChem (CID 102925442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).