C9H13NO3S — CID 106923970
2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3-oxazole (PubChem CID 106923970) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3-oxazole.
| Compound Name | 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3-oxazole |
|---|---|
| PubChem CID | 106923970 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 2-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3-oxazole |
| SMILES | c1coc(SCCC2OCCCO2)n1 |
| InChI | InChI=1S/C9H13NO3S/c1-4-11-8(12-5-1)2-7-14-9-10-3-6-13-9/h3,6,8H,1-2,4-5,7H2 |
| InChIKey | IWTIVLMQIYEONN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |