About 1-cyclopentyl-2-(1,3-oxazol-2-ylsulfanyl)ethanone
1-cyclopentyl-2-(1,3-oxazol-2-ylsulfanyl)ethanone (PubChem CID 106923940) has the molecular formula C10H13NO2S
and a molecular weight of 211.29 g/mol. Its IUPAC name is 1-cyclopentyl-2-(1,3-oxazol-2-ylsulfanyl)ethanone.
Molecular Properties
| Compound Name | 1-cyclopentyl-2-(1,3-oxazol-2-ylsulfanyl)ethanone |
| PubChem CID | 106923940 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 1-cyclopentyl-2-(1,3-oxazol-2-ylsulfanyl)ethanone |
| SMILES | O=C(CSc1ncco1)C1CCCC1 |
| InChI | InChI=1S/C10H13NO2S/c12-9(8-3-1-2-4-8)7-14-10-11-5-6-13-10/h5-6,8H,1-4,7H2 |
| InChIKey | VDBHAXMMEVVTPN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclopentyl-2-(1,3-oxazol-2-ylsulfanyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-2-(1,3-oxazol-2-ylsulfanyl)ethanone?
The IUPAC name of 1-cyclopentyl-2-(1,3-oxazol-2-ylsulfanyl)ethanone (CID 106923940) is 1-cyclopentyl-2-(1,3-oxazol-2-ylsulfanyl)ethanone.
What is the SMILES notation for 1-cyclopentyl-2-(1,3-oxazol-2-ylsulfanyl)ethanone?
The canonical SMILES for 1-cyclopentyl-2-(1,3-oxazol-2-ylsulfanyl)ethanone is O=C(CSc1ncco1)C1CCCC1.
What is the InChIKey of 1-cyclopentyl-2-(1,3-oxazol-2-ylsulfanyl)ethanone?
The InChIKey is VDBHAXMMEVVTPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S/c12-9(8-3-1-2-4-8)7-14-10-11-5-6-13-10/h5-6,8H,1-4,7H2.
What are the key properties of 1-cyclopentyl-2-(1,3-oxazol-2-ylsulfanyl)ethanone?
1-cyclopentyl-2-(1,3-oxazol-2-ylsulfanyl)ethanone has a molecular weight of 211.29 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-2-(1,3-oxazol-2-ylsulfanyl)ethanone is sourced from PubChem (CID 106923940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).