C10H16N2OS — CID 122150934
2-(2-piperidin-1-ylethylsulfanyl)-1,3-oxazole (PubChem CID 122150934) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-(2-piperidin-1-ylethylsulfanyl)-1,3-oxazole.
| Compound Name | 2-(2-piperidin-1-ylethylsulfanyl)-1,3-oxazole |
|---|---|
| PubChem CID | 122150934 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-(2-piperidin-1-ylethylsulfanyl)-1,3-oxazole |
| SMILES | c1coc(SCCN2CCCCC2)n1 |
| InChI | InChI=1S/C10H16N2OS/c1-2-5-12(6-3-1)7-9-14-10-11-4-8-13-10/h4,8H,1-3,5-7,9H2 |
| InChIKey | MMHQVDKXTPCPAA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |