C10H15NOS2 — CID 106928097
[1-(1,3-oxazol-2-ylsulfanylmethyl)cyclopentyl]methanethiol (PubChem CID 106928097) has the molecular formula C10H15NOS2 and a molecular weight of 229.37 g/mol. Its IUPAC name is [1-(1,3-oxazol-2-ylsulfanylmethyl)cyclopentyl]methanethiol.
| Compound Name | [1-(1,3-oxazol-2-ylsulfanylmethyl)cyclopentyl]methanethiol |
|---|---|
| PubChem CID | 106928097 |
| Molecular Formula | C10H15NOS2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | [1-(1,3-oxazol-2-ylsulfanylmethyl)cyclopentyl]methanethiol |
| SMILES | SCC1(CSc2ncco2)CCCC1 |
| InChI | InChI=1S/C10H15NOS2/c13-7-10(3-1-2-4-10)8-14-9-11-5-6-12-9/h5-6,13H,1-4,7-8H2 |
| InChIKey | IURIJOAJCCUYIN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|