C13H21N3O2S2 — CID 107784796
2-methyl-3-[[1-(sulfanylmethyl)cycloheptyl]methylsulfanyl]-1H-1,2,4-triazine-5,6-dione (PubChem CID 107784796) has the molecular formula C13H21N3O2S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-methyl-3-[[1-(sulfanylmethyl)cycloheptyl]methylsulfanyl]-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 2-methyl-3-[[1-(sulfanylmethyl)cycloheptyl]methylsulfanyl]-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107784796 |
| Molecular Formula | C13H21N3O2S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-methyl-3-[[1-(sulfanylmethyl)cycloheptyl]methylsulfanyl]-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SCC1(CS)CCCCCC1 |
| InChI | InChI=1S/C13H21N3O2S2/c1-16-12(14-10(17)11(18)15-16)20-9-13(8-19)6-4-2-3-5-7-13/h19H,2-9H2,1H3,(H,15,18) |
| InChIKey | HBGBHVVZODPFTM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|