C10H14N4O5S — CID 107785538
methyl 2-acetamido-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]propanoate (PubChem CID 107785538) has the molecular formula C10H14N4O5S and a molecular weight of 302.31 g/mol. Its IUPAC name is methyl 2-acetamido-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]propanoate.
| Compound Name | methyl 2-acetamido-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 107785538 |
| Molecular Formula | C10H14N4O5S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | methyl 2-acetamido-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]propanoate |
| SMILES | COC(=O)C(CSc1nc(=O)c(=O)[nH]n1C)NC(C)=O |
| InChI | InChI=1S/C10H14N4O5S/c1-5(15)11-6(9(18)19-3)4-20-10-12-7(16)8(17)13-14(10)2/h6H,4H2,1-3H3,(H,11,15)(H,13,17) |
| InChIKey | HENPMBFHMTZDHI-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 123.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|