C9H11NO3S — CID 106924005
2-(1,3-oxazol-2-ylsulfanyl)-1-(oxolan-3-yl)ethanone (PubChem CID 106924005) has the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. Its IUPAC name is 2-(1,3-oxazol-2-ylsulfanyl)-1-(oxolan-3-yl)ethanone.
| Compound Name | 2-(1,3-oxazol-2-ylsulfanyl)-1-(oxolan-3-yl)ethanone |
|---|---|
| PubChem CID | 106924005 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 2-(1,3-oxazol-2-ylsulfanyl)-1-(oxolan-3-yl)ethanone |
| SMILES | O=C(CSc1ncco1)C1CCOC1 |
| InChI | InChI=1S/C9H11NO3S/c11-8(7-1-3-12-5-7)6-14-9-10-2-4-13-9/h2,4,7H,1,3,5-6H2 |
| InChIKey | FYZCAROOYMSMKV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |