C12H12Cl2O2S — CID 104693468
2-(2,5-dichlorophenyl)sulfanyl-1-(oxolan-3-yl)ethanone (PubChem CID 104693468) has the molecular formula C12H12Cl2O2S and a molecular weight of 291.20 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-1-(oxolan-3-yl)ethanone.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-1-(oxolan-3-yl)ethanone |
|---|---|
| PubChem CID | 104693468 |
| Molecular Formula | C12H12Cl2O2S |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-1-(oxolan-3-yl)ethanone |
| SMILES | O=C(CSc1cc(Cl)ccc1Cl)C1CCOC1 |
| InChI | InChI=1S/C12H12Cl2O2S/c13-9-1-2-10(14)12(5-9)17-7-11(15)8-3-4-16-6-8/h1-2,5,8H,3-4,6-7H2 |
| InChIKey | PNCTVZAIGXSYBF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |