C14H12Cl2N2O2S — CID 91641622
2-cyano-N-cyclopropyl-4-(2,5-dichlorophenyl)sulfanyl-3-oxobutanamide (PubChem CID 91641622) has the molecular formula C14H12Cl2N2O2S and a molecular weight of 343.24 g/mol. Its IUPAC name is 2-cyano-N-cyclopropyl-4-(2,5-dichlorophenyl)sulfanyl-3-oxobutanamide.
| Compound Name | 2-cyano-N-cyclopropyl-4-(2,5-dichlorophenyl)sulfanyl-3-oxobutanamide |
|---|---|
| PubChem CID | 91641622 |
| Molecular Formula | C14H12Cl2N2O2S |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 2-cyano-N-cyclopropyl-4-(2,5-dichlorophenyl)sulfanyl-3-oxobutanamide |
| SMILES | N#CC(C(=O)CSc1cc(Cl)ccc1Cl)C(=O)NC1CC1 |
| InChI | InChI=1S/C14H12Cl2N2O2S/c15-8-1-4-11(16)13(5-8)21-7-12(19)10(6-17)14(20)18-9-2-3-9/h1,4-5,9-10H,2-3,7H2,(H,18,20) |
| InChIKey | MVDLJYHJZKVPBQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|