C17H15Cl2NOS — CID 8623361
N-cyclopropyl-4-[(2,5-dichlorophenyl)sulfanylmethyl]benzamide (PubChem CID 8623361) has the molecular formula C17H15Cl2NOS and a molecular weight of 352.29 g/mol. Its IUPAC name is N-cyclopropyl-4-[(2,5-dichlorophenyl)sulfanylmethyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(2,5-dichlorophenyl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 8623361 |
| Molecular Formula | C17H15Cl2NOS |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | N-cyclopropyl-4-[(2,5-dichlorophenyl)sulfanylmethyl]benzamide |
| SMILES | O=C(NC1CC1)c1ccc(CSc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2NOS/c18-13-5-8-15(19)16(9-13)22-10-11-1-3-12(4-2-11)17(21)20-14-6-7-14/h1-5,8-9,14H,6-7,10H2,(H,20,21) |
| InChIKey | AAZBXVFVXOUOHP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |