C18H16Cl2N2O2S — CID 55489180
N-cyclopropyl-4-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]benzamide (PubChem CID 55489180) has the molecular formula C18H16Cl2N2O2S and a molecular weight of 395.31 g/mol. Its IUPAC name is N-cyclopropyl-4-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]benzamide.
| Compound Name | N-cyclopropyl-4-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 55489180 |
| Molecular Formula | C18H16Cl2N2O2S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | N-cyclopropyl-4-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]benzamide |
| SMILES | O=C(CSc1cc(Cl)ccc1Cl)Nc1ccc(C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C18H16Cl2N2O2S/c19-12-3-8-15(20)16(9-12)25-10-17(23)21-13-4-1-11(2-5-13)18(24)22-14-6-7-14/h1-5,8-9,14H,6-7,10H2,(H,21,23)(H,22,24) |
| InChIKey | QSKKRVAIEBSIJJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |