C19H21Cl2N3OS — CID 30857693
2-(2,5-dichlorophenyl)sulfanyl-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide (PubChem CID 30857693) has the molecular formula C19H21Cl2N3OS and a molecular weight of 410.37 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 30857693 |
| Molecular Formula | C19H21Cl2N3OS |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CSc3cc(Cl)ccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C19H21Cl2N3OS/c1-23-8-10-24(11-9-23)16-5-3-15(4-6-16)22-19(25)13-26-18-12-14(20)2-7-17(18)21/h2-7,12H,8-11,13H2,1H3,(H,22,25) |
| InChIKey | GSXASRNYFPKWAM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|