C19H23Cl2N3O — CID 7368156
2-cyano-N-cyclohexyl-3-[2-(2,4-dichlorophenyl)ethylimino]butanamide (PubChem CID 7368156) has the molecular formula C19H23Cl2N3O and a molecular weight of 380.32 g/mol. Its IUPAC name is 2-cyano-N-cyclohexyl-3-[2-(2,4-dichlorophenyl)ethylimino]butanamide.
| Compound Name | 2-cyano-N-cyclohexyl-3-[2-(2,4-dichlorophenyl)ethylimino]butanamide |
|---|---|
| PubChem CID | 7368156 |
| Molecular Formula | C19H23Cl2N3O |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-cyano-N-cyclohexyl-3-[2-(2,4-dichlorophenyl)ethylimino]butanamide |
| SMILES | C/C(=N\CCc1ccc(Cl)cc1Cl)C(C#N)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H23Cl2N3O/c1-13(23-10-9-14-7-8-15(20)11-18(14)21)17(12-22)19(25)24-16-5-3-2-4-6-16/h7-8,11,16-17H,2-6,9-10H2,1H3,(H,24,25)/b23-13+ |
| InChIKey | ADRMPVCIFIZNLI-YDZHTSKRSA-N |
| XLogP | 4.59 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|