C20H28Cl2N2O2 — CID 113123314
3-[acetyl-[2-(2,4-dichlorophenyl)ethyl]amino]-N-cycloheptylpropanamide (PubChem CID 113123314) has the molecular formula C20H28Cl2N2O2 and a molecular weight of 399.36 g/mol. Its IUPAC name is 3-[acetyl-[2-(2,4-dichlorophenyl)ethyl]amino]-N-cycloheptylpropanamide.
| Compound Name | 3-[acetyl-[2-(2,4-dichlorophenyl)ethyl]amino]-N-cycloheptylpropanamide |
|---|---|
| PubChem CID | 113123314 |
| Molecular Formula | C20H28Cl2N2O2 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 3-[acetyl-[2-(2,4-dichlorophenyl)ethyl]amino]-N-cycloheptylpropanamide |
| SMILES | CC(=O)N(CCC(=O)NC1CCCCCC1)CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H28Cl2N2O2/c1-15(25)24(12-10-16-8-9-17(21)14-19(16)22)13-11-20(26)23-18-6-4-2-3-5-7-18/h8-9,14,18H,2-7,10-13H2,1H3,(H,23,26) |
| InChIKey | TXZNFKXRKIKOMI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |