C22H25Cl2N3O3 — CID 42709387
3-cyclohexyl-1-[2-(2,4-dichlorophenyl)ethyl]-1-[(2-nitrophenyl)methyl]urea (PubChem CID 42709387) has the molecular formula C22H25Cl2N3O3 and a molecular weight of 450.37 g/mol. Its IUPAC name is 3-cyclohexyl-1-[2-(2,4-dichlorophenyl)ethyl]-1-[(2-nitrophenyl)methyl]urea.
| Compound Name | 3-cyclohexyl-1-[2-(2,4-dichlorophenyl)ethyl]-1-[(2-nitrophenyl)methyl]urea |
|---|---|
| PubChem CID | 42709387 |
| Molecular Formula | C22H25Cl2N3O3 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 3-cyclohexyl-1-[2-(2,4-dichlorophenyl)ethyl]-1-[(2-nitrophenyl)methyl]urea |
| SMILES | O=C(NC1CCCCC1)N(CCc1ccc(Cl)cc1Cl)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25Cl2N3O3/c23-18-11-10-16(20(24)14-18)12-13-26(22(28)25-19-7-2-1-3-8-19)15-17-6-4-5-9-21(17)27(29)30/h4-6,9-11,14,19H,1-3,7-8,12-13,15H2,(H,25,28) |
| InChIKey | TYJYOKPQQKGUKR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|