C14H17Cl2NOS — CID 27101870
O-[(2,4-dichlorophenyl)methyl] N-cyclohexylcarbamothioate (PubChem CID 27101870) has the molecular formula C14H17Cl2NOS and a molecular weight of 318.27 g/mol. Its IUPAC name is O-[(2,4-dichlorophenyl)methyl] N-cyclohexylcarbamothioate.
| Compound Name | O-[(2,4-dichlorophenyl)methyl] N-cyclohexylcarbamothioate |
|---|---|
| PubChem CID | 27101870 |
| Molecular Formula | C14H17Cl2NOS |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | O-[(2,4-dichlorophenyl)methyl] N-cyclohexylcarbamothioate |
| SMILES | S=C(NC1CCCCC1)OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2NOS/c15-11-7-6-10(13(16)8-11)9-18-14(19)17-12-4-2-1-3-5-12/h6-8,12H,1-5,9H2,(H,17,19) |
| InChIKey | MGXKUZUNHWKTDQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|