C17H17Cl2NO4 — CID 46792376
(2,4-dichlorophenyl)methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate (PubChem CID 46792376) has the molecular formula C17H17Cl2NO4 and a molecular weight of 370.23 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate.
| Compound Name | (2,4-dichlorophenyl)methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 46792376 |
| Molecular Formula | C17H17Cl2NO4 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | (2,4-dichlorophenyl)methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)C2CCCCC2C1=O)OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl2NO4/c18-11-6-5-10(14(19)7-11)9-24-15(21)8-20-16(22)12-3-1-2-4-13(12)17(20)23/h5-7,12-13H,1-4,8-9H2 |
| InChIKey | NSAGKMJWCNUSLK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|