C18H20FNO5 — CID 7906738
(3-fluoro-4-methoxyphenyl)methyl 2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate (PubChem CID 7906738) has the molecular formula C18H20FNO5 and a molecular weight of 349.36 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl 2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl 2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 7906738 |
| Molecular Formula | C18H20FNO5 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl 2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
| SMILES | COc1ccc(COC(=O)CN2C(=O)[C@H]3CCCC[C@H]3C2=O)cc1F |
| InChI | InChI=1S/C18H20FNO5/c1-24-15-7-6-11(8-14(15)19)10-25-16(21)9-20-17(22)12-4-2-3-5-13(12)18(20)23/h6-8,12-13H,2-5,9-10H2,1H3/t12-,13+ |
| InChIKey | YYPXXQYYISVILL-BETUJISGSA-N |
| XLogP | 2.05 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|