C17H17ClFNO4 — CID 7906828
(2-chloro-6-fluorophenyl)methyl 2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate (PubChem CID 7906828) has the molecular formula C17H17ClFNO4 and a molecular weight of 353.78 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl 2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl 2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 7906828 |
| Molecular Formula | C17H17ClFNO4 |
| Molecular Weight | 353.78 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl 2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
| SMILES | O=C(CN1C(=O)[C@H]2CCCC[C@H]2C1=O)OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H17ClFNO4/c18-13-6-3-7-14(19)12(13)9-24-15(21)8-20-16(22)10-4-1-2-5-11(10)17(20)23/h3,6-7,10-11H,1-2,4-5,8-9H2/t10-,11+ |
| InChIKey | BWGVNNZGQPECTK-PHIMTYICSA-N |
| XLogP | 2.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.78 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|