C14H16ClFO2 — CID 2436177
(2-chloro-6-fluorophenyl)methyl cyclohexanecarboxylate (PubChem CID 2436177) has the molecular formula C14H16ClFO2 and a molecular weight of 270.73 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl cyclohexanecarboxylate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 2436177 |
| Molecular Formula | C14H16ClFO2 |
| Molecular Weight | 270.73 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl cyclohexanecarboxylate |
| SMILES | O=C(OCc1c(F)cccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C14H16ClFO2/c15-12-7-4-8-13(16)11(12)9-18-14(17)10-5-2-1-3-6-10/h4,7-8,10H,1-3,5-6,9H2 |
| InChIKey | RJAIYFROXBXTDI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.73 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |