C19H21NO6 — CID 46516650
methyl 4-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxymethyl]benzoate (PubChem CID 46516650) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is methyl 4-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxymethyl]benzoate.
| Compound Name | methyl 4-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 46516650 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | methyl 4-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COC(=O)CN2C(=O)C3CCCCC3C2=O)cc1 |
| InChI | InChI=1S/C19H21NO6/c1-25-19(24)13-8-6-12(7-9-13)11-26-16(21)10-20-17(22)14-4-2-3-5-15(14)18(20)23/h6-9,14-15H,2-5,10-11H2,1H3 |
| InChIKey | GUQJGXYSFJRRRF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|