C24H22N2O4 — CID 46511567
[4-(2-cyanophenyl)phenyl]methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate (PubChem CID 46511567) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is [4-(2-cyanophenyl)phenyl]methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate.
| Compound Name | [4-(2-cyanophenyl)phenyl]methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 46511567 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [4-(2-cyanophenyl)phenyl]methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
| SMILES | N#Cc1ccccc1-c1ccc(COC(=O)CN2C(=O)C3CCCCC3C2=O)cc1 |
| InChI | InChI=1S/C24H22N2O4/c25-13-18-5-1-2-6-19(18)17-11-9-16(10-12-17)15-30-22(27)14-26-23(28)20-7-3-4-8-21(20)24(26)29/h1-2,5-6,9-12,20-21H,3-4,7-8,14-15H2 |
| InChIKey | XDEIBUDQTMTZMX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|