C25H25N3O4 — CID 31146910
[4-(2-cyanophenyl)phenyl]methyl 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate (PubChem CID 31146910) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is [4-(2-cyanophenyl)phenyl]methyl 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate.
| Compound Name | [4-(2-cyanophenyl)phenyl]methyl 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate |
|---|---|
| PubChem CID | 31146910 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | [4-(2-cyanophenyl)phenyl]methyl 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate |
| SMILES | N#Cc1ccccc1-c1ccc(COC(=O)CCN2C(=O)NC3(CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C25H25N3O4/c26-16-20-6-2-3-7-21(20)19-10-8-18(9-11-19)17-32-22(29)12-15-28-23(30)25(27-24(28)31)13-4-1-5-14-25/h2-3,6-11H,1,4-5,12-15,17H2,(H,27,31) |
| InChIKey | OOZUUIGMINGQAF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|